C17H14N2O5 — CID 126065123
methyl 3-[5-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoate (PubChem CID 126065123) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 3-[5-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[5-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 126065123 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 3-[5-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(/C=C3/NC(=O)NC3=O)o2)c1C |
| InChI | InChI=1S/C17H14N2O5/c1-9-11(4-3-5-12(9)16(21)23-2)14-7-6-10(24-14)8-13-15(20)19-17(22)18-13/h3-8H,1-2H3,(H2,18,19,20,22)/b13-8+ |
| InChIKey | SSHLXGGSMKCJKI-MDWZMJQESA-N |
| XLogP | 2.22 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|