C25H22N2O5S — CID 137079494
methyl 3-[5-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate (PubChem CID 137079494) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is methyl 3-[5-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[5-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 137079494 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | methyl 3-[5-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3ccc(-c4cccc(C(=O)OC)c4C)o3)S2)cc1 |
| InChI | InChI=1S/C25H22N2O5S/c1-4-31-17-10-8-16(9-11-17)26-25-27-23(28)22(33-25)14-18-12-13-21(32-18)19-6-5-7-20(15(19)2)24(29)30-3/h5-14H,4H2,1-3H3,(H,26,27,28)/b22-14+ |
| InChIKey | VHJJYYIKKSHSSW-HYARGMPZSA-N |
| XLogP | 5.33 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|