C22H14Cl2N2O4S — CID 137079862
methyl 2-[5-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 137079862) has the molecular formula C22H14Cl2N2O4S and a molecular weight of 473.34 g/mol. Its IUPAC name is methyl 2-[5-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 137079862 |
| Molecular Formula | C22H14Cl2N2O4S |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | methyl 2-[5-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=C2/S/C(=N\c3cccc(Cl)c3Cl)NC2=O)o1 |
| InChI | InChI=1S/C22H14Cl2N2O4S/c1-29-21(28)14-6-3-2-5-13(14)17-10-9-12(30-17)11-18-20(27)26-22(31-18)25-16-8-4-7-15(23)19(16)24/h2-11H,1H3,(H,25,26,27)/b18-11+ |
| InChIKey | ASXXAKIHUBDYOS-WOJGMQOQSA-N |
| XLogP | 5.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|