C22H16Cl2N2O2S — CID 137166659
(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137166659) has the molecular formula C22H16Cl2N2O2S and a molecular weight of 443.36 g/mol. Its IUPAC name is (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137166659 |
| Molecular Formula | C22H16Cl2N2O2S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)/C(=C\c3ccc(-c4cccc(Cl)c4Cl)o3)S2)c(C)c1 |
| InChI | InChI=1S/C22H16Cl2N2O2S/c1-12-6-8-17(13(2)10-12)25-22-26-21(27)19(29-22)11-14-7-9-18(28-14)15-4-3-5-16(23)20(15)24/h3-11H,1-2H3,(H,25,26,27)/b19-11+ |
| InChIKey | HDNVLBNQEXJNAK-YBFXNURJSA-N |
| XLogP | 6.76 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|