C22H17IN2O2S — CID 137089491
(5E)-2-(2,4-dimethylphenyl)imino-5-[[5-(4-iodophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137089491) has the molecular formula C22H17IN2O2S and a molecular weight of 500.36 g/mol. Its IUPAC name is (5E)-2-(2,4-dimethylphenyl)imino-5-[[5-(4-iodophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,4-dimethylphenyl)imino-5-[[5-(4-iodophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137089491 |
| Molecular Formula | C22H17IN2O2S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | (5E)-2-(2,4-dimethylphenyl)imino-5-[[5-(4-iodophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C\c3ccc(-c4ccc(I)cc4)o3)S2)c(C)c1 |
| InChI | InChI=1S/C22H17IN2O2S/c1-13-3-9-18(14(2)11-13)24-22-25-21(26)20(28-22)12-17-8-10-19(27-17)15-4-6-16(23)7-5-15/h3-12H,1-2H3,(H,24,25,26)/b20-12+ |
| InChIKey | HXLYVEVDSKRPEX-UDWIEESQSA-N |
| XLogP | 6.06 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|