C28H21NO5S — CID 21376963
methyl 2-methyl-3-[5-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 21376963) has the molecular formula C28H21NO5S and a molecular weight of 483.55 g/mol. Its IUPAC name is methyl 2-methyl-3-[5-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-methyl-3-[5-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 21376963 |
| Molecular Formula | C28H21NO5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | methyl 2-methyl-3-[5-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(/C=C3/SC(=O)N(Cc4cccc5ccccc45)C3=O)o2)c1C |
| InChI | InChI=1S/C28H21NO5S/c1-17-21(11-6-12-22(17)27(31)33-2)24-14-13-20(34-24)15-25-26(30)29(28(32)35-25)16-19-9-5-8-18-7-3-4-10-23(18)19/h3-15H,16H2,1-2H3/b25-15+ |
| InChIKey | ZZOSRXQSEDWRLI-MFKUBSTISA-N |
| XLogP | 6.43 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|