C22H21NO7S — CID 126115437
methyl 3-[5-[(E)-[2,4-dioxo-3-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate (PubChem CID 126115437) has the molecular formula C22H21NO7S and a molecular weight of 443.48 g/mol. Its IUPAC name is methyl 3-[5-[(E)-[2,4-dioxo-3-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[5-[(E)-[2,4-dioxo-3-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 126115437 |
| Molecular Formula | C22H21NO7S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl 3-[5-[(E)-[2,4-dioxo-3-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(/C=C3/SC(=O)N(CC(=O)OC(C)C)C3=O)o2)c1C |
| InChI | InChI=1S/C22H21NO7S/c1-12(2)29-19(24)11-23-20(25)18(31-22(23)27)10-14-8-9-17(30-14)15-6-5-7-16(13(15)3)21(26)28-4/h5-10,12H,11H2,1-4H3/b18-10+ |
| InChIKey | XXKOKEPCQCUEDC-VCHYOVAHSA-N |
| XLogP | 4.03 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|