C19H16BrNO5S — CID 1228017
propan-2-yl 2-[5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 1228017) has the molecular formula C19H16BrNO5S and a molecular weight of 450.31 g/mol. Its IUPAC name is propan-2-yl 2-[5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1228017 |
| Molecular Formula | C19H16BrNO5S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | propan-2-yl 2-[5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)SC(=Cc2ccc(-c3cccc(Br)c3)o2)C1=O |
| InChI | InChI=1S/C19H16BrNO5S/c1-11(2)25-17(22)10-21-18(23)16(27-19(21)24)9-14-6-7-15(26-14)12-4-3-5-13(20)8-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | ZZJJAQNSVBVNPF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|