C23H22ClNO7S — CID 126220345
ethyl 5-[5-[(E)-[3-[2-[(2S)-butan-2-yl]oxy-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 126220345) has the molecular formula C23H22ClNO7S and a molecular weight of 491.95 g/mol. Its IUPAC name is ethyl 5-[5-[(E)-[3-[2-[(2S)-butan-2-yl]oxy-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[5-[(E)-[3-[2-[(2S)-butan-2-yl]oxy-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126220345 |
| Molecular Formula | C23H22ClNO7S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | ethyl 5-[5-[(E)-[3-[2-[(2S)-butan-2-yl]oxy-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=C3/SC(=O)N(CC(=O)O[C@@H](C)CC)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C23H22ClNO7S/c1-4-13(3)31-20(26)12-25-21(27)19(33-23(25)29)11-15-7-9-18(32-15)14-6-8-17(24)16(10-14)22(28)30-5-2/h6-11,13H,4-5,12H2,1-3H3/b19-11+/t13-/m0/s1 |
| InChIKey | WGQBZZPULHVPEY-MDBUFAAASA-N |
| XLogP | 5.15 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|