C20H18ClNO5S — CID 126362706
ethyl 2-chloro-5-[5-[(E)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 126362706) has the molecular formula C20H18ClNO5S and a molecular weight of 419.89 g/mol. Its IUPAC name is ethyl 2-chloro-5-[5-[(E)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[5-[(E)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126362706 |
| Molecular Formula | C20H18ClNO5S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | ethyl 2-chloro-5-[5-[(E)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCCN1C(=O)S/C(=C/c2ccc(-c3ccc(Cl)c(C(=O)OCC)c3)o2)C1=O |
| InChI | InChI=1S/C20H18ClNO5S/c1-3-9-22-18(23)17(28-20(22)25)11-13-6-8-16(27-13)12-5-7-15(21)14(10-12)19(24)26-4-2/h5-8,10-11H,3-4,9H2,1-2H3/b17-11+ |
| InChIKey | IOTNJXQVOKWQBC-GZTJUZNOSA-N |
| XLogP | 5.22 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|