C24H17ClN2O5S2 — CID 126200102
ethyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 126200102) has the molecular formula C24H17ClN2O5S2 and a molecular weight of 513.00 g/mol. Its IUPAC name is ethyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126200102 |
| Molecular Formula | C24H17ClN2O5S2 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | ethyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=C3/SC(=S)N(NC(=O)c4ccccc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C24H17ClN2O5S2/c1-2-31-23(30)17-12-15(8-10-18(17)25)19-11-9-16(32-19)13-20-22(29)27(24(33)34-20)26-21(28)14-6-4-3-5-7-14/h3-13H,2H2,1H3,(H,26,28)/b20-13+ |
| InChIKey | GTBXRDJIPGULQD-DEDYPNTBSA-N |
| XLogP | 5.32 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|