C24H18ClNO5S — CID 124663478
ethyl 5-[5-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 124663478) has the molecular formula C24H18ClNO5S and a molecular weight of 467.93 g/mol. Its IUPAC name is ethyl 5-[5-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[5-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 124663478 |
| Molecular Formula | C24H18ClNO5S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | ethyl 5-[5-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=C3/SC(=O)N(Cc4ccccc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C24H18ClNO5S/c1-2-30-23(28)18-12-16(8-10-19(18)25)20-11-9-17(31-20)13-21-22(27)26(24(29)32-21)14-15-6-4-3-5-7-15/h3-13H,2,14H2,1H3/b21-13+ |
| InChIKey | JGFCEQUQAUCYTJ-FYJGNVAPSA-N |
| XLogP | 6.01 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|