C26H21Cl2NO5S — CID 124666293
butyl 4-[5-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 124666293) has the molecular formula C26H21Cl2NO5S and a molecular weight of 530.43 g/mol. Its IUPAC name is butyl 4-[5-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 124666293 |
| Molecular Formula | C26H21Cl2NO5S |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | butyl 4-[5-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(/C=C3/SC(=O)N(Cc4ccc(Cl)c(Cl)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C26H21Cl2NO5S/c1-2-3-12-33-25(31)18-7-5-17(6-8-18)22-11-9-19(34-22)14-23-24(30)29(26(32)35-23)15-16-4-10-20(27)21(28)13-16/h4-11,13-14H,2-3,12,15H2,1H3/b23-14+ |
| InChIKey | BXEZQRXIBXRRPA-OEAKJJBVSA-N |
| XLogP | 7.45 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|