C25H19BrClNO4S2 — CID 126334825
butyl 4-[5-[(E)-[3-(4-bromo-3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126334825) has the molecular formula C25H19BrClNO4S2 and a molecular weight of 576.92 g/mol. Its IUPAC name is butyl 4-[5-[(E)-[3-(4-bromo-3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[(E)-[3-(4-bromo-3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126334825 |
| Molecular Formula | C25H19BrClNO4S2 |
| Molecular Weight | 576.92 g/mol |
| Exact Mass | 574.96 |
| IUPAC Name | butyl 4-[5-[(E)-[3-(4-bromo-3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(/C=C3/SC(=S)N(c4ccc(Br)c(Cl)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H19BrClNO4S2/c1-2-3-12-31-24(30)16-6-4-15(5-7-16)21-11-9-18(32-21)14-22-23(29)28(25(33)34-22)17-8-10-19(26)20(27)13-17/h4-11,13-14H,2-3,12H2,1H3/b22-14+ |
| InChIKey | ZTVIUEOSZPCGPF-HYARGMPZSA-N |
| XLogP | 7.73 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.92 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|