C23H14F3NO4S2 — CID 2921854
methyl 4-[5-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2921854) has the molecular formula C23H14F3NO4S2 and a molecular weight of 489.50 g/mol. Its IUPAC name is methyl 4-[5-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2921854 |
| Molecular Formula | C23H14F3NO4S2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | methyl 4-[5-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C=C3SC(=S)N(c4cccc(C(F)(F)F)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C23H14F3NO4S2/c1-30-21(29)14-7-5-13(6-8-14)18-10-9-17(31-18)12-19-20(28)27(22(32)33-19)16-4-2-3-15(11-16)23(24,25)26/h2-12H,1H3 |
| InChIKey | GLKQQWQCDXYZGD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|