C22H18F3NO3S2 — CID 4762447
butyl 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 4762447) has the molecular formula C22H18F3NO3S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is butyl 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | butyl 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4762447 |
| Molecular Formula | C22H18F3NO3S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | butyl 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(C=C2SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H18F3NO3S2/c1-2-3-11-29-20(28)15-9-7-14(8-10-15)12-18-19(27)26(21(30)31-18)17-6-4-5-16(13-17)22(23,24)25/h4-10,12-13H,2-3,11H2,1H3 |
| InChIKey | DXEMQAUZGDOVTI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|