C25H17F3N2O3S2 — CID 126264468
2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 126264468) has the molecular formula C25H17F3N2O3S2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126264468 |
| Molecular Formula | C25H17F3N2O3S2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(/C=C2\SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C25H17F3N2O3S2/c26-25(27,28)17-5-4-8-19(14-17)30-23(32)21(35-24(30)34)13-16-9-11-20(12-10-16)33-15-22(31)29-18-6-2-1-3-7-18/h1-14H,15H2,(H,29,31)/b21-13- |
| InChIKey | VXZIBZPFQYEODN-BKUYFWCQSA-N |
| XLogP | 6.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|