C25H15Cl2F3N2O3S2 — CID 126246636
N-(3,4-dichlorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126246636) has the molecular formula C25H15Cl2F3N2O3S2 and a molecular weight of 583.44 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126246636 |
| Molecular Formula | C25H15Cl2F3N2O3S2 |
| Molecular Weight | 583.44 g/mol |
| Exact Mass | 581.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(/C=C2\SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H15Cl2F3N2O3S2/c26-19-9-6-16(12-20(19)27)31-22(33)13-35-18-7-4-14(5-8-18)10-21-23(34)32(24(36)37-21)17-3-1-2-15(11-17)25(28,29)30/h1-12H,13H2,(H,31,33)/b21-10- |
| InChIKey | PUCIFIOYTPDSOF-FBHDLOMBSA-N |
| XLogP | 7.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.44 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|