C28H23F3N2O3S2 — CID 126235196
2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126235196) has the molecular formula C28H23F3N2O3S2 and a molecular weight of 556.63 g/mol. Its IUPAC name is 2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126235196 |
| Molecular Formula | C28H23F3N2O3S2 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2ccc(/C=C3\SC(=S)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C28H23F3N2O3S2/c1-16-11-17(2)25(18(3)12-16)32-24(34)15-36-22-9-7-19(8-10-22)13-23-26(35)33(27(37)38-23)21-6-4-5-20(14-21)28(29,30)31/h4-14H,15H2,1-3H3,(H,32,34)/b23-13- |
| InChIKey | IIJYVXNDFHNSMM-QRVIBDJDSA-N |
| XLogP | 7.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|