C25H16F4N2O3S2 — CID 126274792
N-(4-fluorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126274792) has the molecular formula C25H16F4N2O3S2 and a molecular weight of 532.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126274792 |
| Molecular Formula | C25H16F4N2O3S2 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(Z)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(/C=C2\SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H16F4N2O3S2/c26-17-6-8-18(9-7-17)30-22(32)14-34-20-10-4-15(5-11-20)12-21-23(33)31(24(35)36-21)19-3-1-2-16(13-19)25(27,28)29/h1-13H,14H2,(H,30,32)/b21-12- |
| InChIKey | WTXFVAINHWKXDW-MTJSOVHGSA-N |
| XLogP | 6.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|