C23H23NO3S2 — CID 2929453
ethyl 4-[5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 2929453) has the molecular formula C23H23NO3S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is ethyl 4-[5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 2929453 |
| Molecular Formula | C23H23NO3S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | ethyl 4-[5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=Cc3ccc(C(C)(C)C)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C23H23NO3S2/c1-5-27-21(26)16-8-12-18(13-9-16)24-20(25)19(29-22(24)28)14-15-6-10-17(11-7-15)23(2,3)4/h6-14H,5H2,1-4H3 |
| InChIKey | QECBFCQKWSMWGU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|