C19H14FNO3S2 — CID 122713911
ethyl 4-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 122713911) has the molecular formula C19H14FNO3S2 and a molecular weight of 387.46 g/mol. Its IUPAC name is ethyl 4-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 122713911 |
| Molecular Formula | C19H14FNO3S2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | ethyl 4-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)/C(=C/c3ccc(F)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C19H14FNO3S2/c1-2-24-18(23)13-5-9-15(10-6-13)21-17(22)16(26-19(21)25)11-12-3-7-14(20)8-4-12/h3-11H,2H2,1H3/b16-11- |
| InChIKey | GKYDUWZOXCIFNO-WJDWOHSUSA-N |
| XLogP | 4.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|