C18H15N2O3S2+ — CID 5218665
ethyl 4-[4-oxo-5-(pyridin-1-ium-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 5218665) has the molecular formula C18H15N2O3S2+ and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 4-[4-oxo-5-(pyridin-1-ium-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[4-oxo-5-(pyridin-1-ium-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 5218665 |
| Molecular Formula | C18H15N2O3S2+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | ethyl 4-[4-oxo-5-(pyridin-1-ium-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=Cc3ccc[nH+]c3)SC2=S)cc1 |
| InChI | InChI=1S/C18H14N2O3S2/c1-2-23-17(22)13-5-7-14(8-6-13)20-16(21)15(25-18(20)24)10-12-4-3-9-19-11-12/h3-11H,2H2,1H3/p+1 |
| InChIKey | SLEMQNUPECRUFZ-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|