C23H21NO3S2 — CID 122713869
butyl 4-[(5Z)-4-oxo-5-[(Z)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 122713869) has the molecular formula C23H21NO3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is butyl 4-[(5Z)-4-oxo-5-[(Z)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | butyl 4-[(5Z)-4-oxo-5-[(Z)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 122713869 |
| Molecular Formula | C23H21NO3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | butyl 4-[(5Z)-4-oxo-5-[(Z)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)/C(=C/C=C\c3ccccc3)SC2=S)cc1 |
| InChI | InChI=1S/C23H21NO3S2/c1-2-3-16-27-22(26)18-12-14-19(15-13-18)24-21(25)20(29-23(24)28)11-7-10-17-8-5-4-6-9-17/h4-15H,2-3,16H2,1H3/b10-7-,20-11- |
| InChIKey | BPVVFTOOZKWACI-LIZKKHSFSA-N |
| XLogP | 5.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|