C18H19NO4S — CID 126220162
butyl 2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 126220162) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is butyl 2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126220162 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | butyl 2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C/C=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C18H19NO4S/c1-2-3-12-23-16(20)13-19-17(21)15(24-18(19)22)11-7-10-14-8-5-4-6-9-14/h4-11H,2-3,12-13H2,1H3/b10-7-,15-11+ |
| InChIKey | USCRTIZQHJUIOK-UAABIVIQSA-N |
| XLogP | 3.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|