C20H15NO3S2 — CID 6206745
2-methyl-5-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 6206745) has the molecular formula C20H15NO3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-methyl-5-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 2-methyl-5-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 6206745 |
| Molecular Formula | C20H15NO3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-methyl-5-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | Cc1ccc(N2C(=O)/C(=C/C=C/c3ccccc3)SC2=S)cc1C(=O)O |
| InChI | InChI=1S/C20H15NO3S2/c1-13-10-11-15(12-16(13)19(23)24)21-18(22)17(26-20(21)25)9-5-8-14-6-3-2-4-7-14/h2-12H,1H3,(H,23,24)/b8-5+,17-9- |
| InChIKey | OQBODYBCMKLXAR-WIXUPIFPSA-N |
| XLogP | 4.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|