C19H12NO3S2- — CID 2046278
4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 2046278) has the molecular formula C19H12NO3S2- and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | 4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 2046278 |
| Molecular Formula | C19H12NO3S2- |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2C(=O)/C(=C/C=C/c3ccccc3)SC2=S)cc1 |
| InChI | InChI=1S/C19H13NO3S2/c21-17-16(8-4-7-13-5-2-1-3-6-13)25-19(24)20(17)15-11-9-14(10-12-15)18(22)23/h1-12H,(H,22,23)/p-1/b7-4+,16-8- |
| InChIKey | AEAPRFCJDOSCGL-QSJINSDNSA-M |
| XLogP | 3.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|