C27H30N2O4S2 — CID 16630323
ethyl 4-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]benzoate (PubChem CID 16630323) has the molecular formula C27H30N2O4S2 and a molecular weight of 510.68 g/mol. Its IUPAC name is ethyl 4-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]benzoate.
| Compound Name | ethyl 4-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]benzoate |
|---|---|
| PubChem CID | 16630323 |
| Molecular Formula | C27H30N2O4S2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | ethyl 4-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCN2C(=O)/C(=C/c3ccc(C(C)(C)C)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C27H30N2O4S2/c1-5-33-25(32)19-10-14-21(15-11-19)28-23(30)7-6-16-29-24(31)22(35-26(29)34)17-18-8-12-20(13-9-18)27(2,3)4/h8-15,17H,5-7,16H2,1-4H3,(H,28,30)/b22-17- |
| InChIKey | LHYZPJMMDXIROF-XLNRJJMWSA-N |
| XLogP | 5.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|