C24H27N3O4S3 — CID 16630398
4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide (PubChem CID 16630398) has the molecular formula C24H27N3O4S3 and a molecular weight of 517.70 g/mol. Its IUPAC name is 4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide.
| Compound Name | 4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 16630398 |
| Molecular Formula | C24H27N3O4S3 |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide |
| SMILES | CC(C)(C)c1ccc(/C=C2\SC(=S)N(CCCC(=O)Nc3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O4S3/c1-24(2,3)17-8-6-16(7-9-17)15-20-22(29)27(23(32)33-20)14-4-5-21(28)26-18-10-12-19(13-11-18)34(25,30)31/h6-13,15H,4-5,14H2,1-3H3,(H,26,28)(H2,25,30,31)/b20-15- |
| InChIKey | GPXSOOWUZAGUAF-HKWRFOASSA-N |
| XLogP | 4.25 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|