C22H23N3O6S3 — CID 16630397
4-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide (PubChem CID 16630397) has the molecular formula C22H23N3O6S3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 4-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide.
| Compound Name | 4-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 16630397 |
| Molecular Formula | C22H23N3O6S3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 4-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)butanamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(CCCC(=O)Nc3ccc(S(N)(=O)=O)cc3)C2=O)ccc1O |
| InChI | InChI=1S/C22H23N3O6S3/c1-2-31-18-12-14(5-10-17(18)26)13-19-21(28)25(22(32)33-19)11-3-4-20(27)24-15-6-8-16(9-7-15)34(23,29)30/h5-10,12-13,26H,2-4,11H2,1H3,(H,24,27)(H2,23,29,30)/b19-13- |
| InChIKey | NFJVEXHIZKXFBL-UYRXBGFRSA-N |
| XLogP | 3.06 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|