C26H30N2O5S2 — CID 4759178
6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)hexanamide (PubChem CID 4759178) has the molecular formula C26H30N2O5S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)hexanamide.
| Compound Name | 6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 4759178 |
| Molecular Formula | C26H30N2O5S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)hexanamide |
| SMILES | CCOc1ccc(NC(=O)CCCCCN2C(=O)C(=Cc3ccc(OC)c(OC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C26H30N2O5S2/c1-4-33-20-12-10-19(11-13-20)27-24(29)8-6-5-7-15-28-25(30)23(35-26(28)34)17-18-9-14-21(31-2)22(16-18)32-3/h9-14,16-17H,4-8,15H2,1-3H3,(H,27,29) |
| InChIKey | HEASBQOTFTYCSE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|