C24H25N3O5S2 — CID 16963500
N-(4-ethoxyphenyl)-6-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 16963500) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-6-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-(4-ethoxyphenyl)-6-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 16963500 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | N-(4-ethoxyphenyl)-6-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | CCOc1ccc(NC(=O)CCCCCN2C(=O)/C(=C/c3ccc([N+](=O)[O-])cc3)SC2=S)cc1 |
| InChI | InChI=1S/C24H25N3O5S2/c1-2-32-20-13-9-18(10-14-20)25-22(28)6-4-3-5-15-26-23(29)21(34-24(26)33)16-17-7-11-19(12-8-17)27(30)31/h7-14,16H,2-6,15H2,1H3,(H,25,28)/b21-16- |
| InChIKey | PYPHXWNLLGSPCR-PGMHBOJBSA-N |
| XLogP | 5.39 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|