C25H26N2O7S2 — CID 6203697
4-[6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid (PubChem CID 6203697) has the molecular formula C25H26N2O7S2 and a molecular weight of 530.62 g/mol. Its IUPAC name is 4-[6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6203697 |
| Molecular Formula | C25H26N2O7S2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 4-[6-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)Nc3ccc(C(=O)O)c(O)c3)C2=O)cc1OC |
| InChI | InChI=1S/C25H26N2O7S2/c1-33-19-10-7-15(12-20(19)34-2)13-21-23(30)27(25(35)36-21)11-5-3-4-6-22(29)26-16-8-9-17(24(31)32)18(28)14-16/h7-10,12-14,28H,3-6,11H2,1-2H3,(H,26,29)(H,31,32)/b21-13- |
| InChIKey | TUCPPTCKSPCEBW-BKUYFWCQSA-N |
| XLogP | 4.51 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|