C25H24N2O7S2 — CID 6203963
2-hydroxy-4-[6-[(5Z)-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid (PubChem CID 6203963) has the molecular formula C25H24N2O7S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-hydroxy-4-[6-[(5Z)-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid.
| Compound Name | 2-hydroxy-4-[6-[(5Z)-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid |
|---|---|
| PubChem CID | 6203963 |
| Molecular Formula | C25H24N2O7S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 2-hydroxy-4-[6-[(5Z)-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid |
| SMILES | COC(=O)c1ccc(/C=C2\SC(=S)N(CCCCCC(=O)Nc3ccc(C(=O)O)c(O)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H24N2O7S2/c1-34-24(33)16-8-6-15(7-9-16)13-20-22(30)27(25(35)36-20)12-4-2-3-5-21(29)26-17-10-11-18(23(31)32)19(28)14-17/h6-11,13-14,28H,2-5,12H2,1H3,(H,26,29)(H,31,32)/b20-13- |
| InChIKey | ZPUIMZFRVLHJJF-MOSHPQCFSA-N |
| XLogP | 4.28 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|