C23H22N2O5S2 — CID 34063887
5-[6-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid (PubChem CID 34063887) has the molecular formula C23H22N2O5S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is 5-[6-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[6-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 34063887 |
| Molecular Formula | C23H22N2O5S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 5-[6-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(CCCCCN1C(=O)/C(=C\c2ccccc2)SC1=S)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H22N2O5S2/c26-18-11-10-16(14-17(18)22(29)30)24-20(27)9-5-2-6-12-25-21(28)19(32-23(25)31)13-15-7-3-1-4-8-15/h1,3-4,7-8,10-11,13-14,26H,2,5-6,9,12H2,(H,24,27)(H,29,30)/b19-13+ |
| InChIKey | QGWXHZIKIJQRHN-CPNJWEJPSA-N |
| XLogP | 4.49 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|