C22H21BrN2O2S2 — CID 16630657
6-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide (PubChem CID 16630657) has the molecular formula C22H21BrN2O2S2 and a molecular weight of 489.46 g/mol. Its IUPAC name is 6-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide.
| Compound Name | 6-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide |
|---|---|
| PubChem CID | 16630657 |
| Molecular Formula | C22H21BrN2O2S2 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 6-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2ccc(Br)cc2)SC1=S)Nc1ccccc1 |
| InChI | InChI=1S/C22H21BrN2O2S2/c23-17-12-10-16(11-13-17)15-19-21(27)25(22(28)29-19)14-6-2-5-9-20(26)24-18-7-3-1-4-8-18/h1,3-4,7-8,10-13,15H,2,5-6,9,14H2,(H,24,26)/b19-15- |
| InChIKey | UTTUUYMDYCDNKG-CYVLTUHYSA-N |
| XLogP | 5.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|