C21H16BrF3N2O2S2 — CID 16630258
4-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 16630258) has the molecular formula C21H16BrF3N2O2S2 and a molecular weight of 529.40 g/mol. Its IUPAC name is 4-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 16630258 |
| Molecular Formula | C21H16BrF3N2O2S2 |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 4-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2ccc(Br)cc2)SC1=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16BrF3N2O2S2/c22-15-8-6-13(7-9-15)11-17-19(29)27(20(30)31-17)10-2-5-18(28)26-16-4-1-3-14(12-16)21(23,24)25/h1,3-4,6-9,11-12H,2,5,10H2,(H,26,28)/b17-11- |
| InChIKey | IDNWHTNLELRVNQ-BOPFTXTBSA-N |
| XLogP | 6.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|