C27H21F3N2O2S2 — CID 16630261
4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 16630261) has the molecular formula C27H21F3N2O2S2 and a molecular weight of 526.61 g/mol. Its IUPAC name is 4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 16630261 |
| Molecular Formula | C27H21F3N2O2S2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2ccc(-c3ccccc3)cc2)SC1=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21F3N2O2S2/c28-27(29,30)21-8-4-9-22(17-21)31-24(33)10-5-15-32-25(34)23(36-26(32)35)16-18-11-13-20(14-12-18)19-6-2-1-3-7-19/h1-4,6-9,11-14,16-17H,5,10,15H2,(H,31,33)/b23-16- |
| InChIKey | LAAGRSCBZHYDQM-KQWNVCNZSA-N |
| XLogP | 6.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|