C24H23F3N2O2S2 — CID 16630855
6-[(5Z)-5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]hexanamide (PubChem CID 16630855) has the molecular formula C24H23F3N2O2S2 and a molecular weight of 492.59 g/mol. Its IUPAC name is 6-[(5Z)-5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]hexanamide.
| Compound Name | 6-[(5Z)-5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 16630855 |
| Molecular Formula | C24H23F3N2O2S2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 6-[(5Z)-5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]hexanamide |
| SMILES | Cc1ccccc1/C=C1\SC(=S)N(CCCCCC(=O)Nc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C24H23F3N2O2S2/c1-16-8-4-5-9-17(16)14-20-22(31)29(23(32)33-20)13-6-2-3-12-21(30)28-19-11-7-10-18(15-19)24(25,26)27/h4-5,7-11,14-15H,2-3,6,12-13H2,1H3,(H,28,30)/b20-14- |
| InChIKey | MCHNKEQLWBOYFV-ZHZULCJRSA-N |
| XLogP | 6.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|