C22H19N2O7S2- — CID 54717643
2-carboxy-5-[3-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate (PubChem CID 54717643) has the molecular formula C22H19N2O7S2- and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-carboxy-5-[3-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate.
| Compound Name | 2-carboxy-5-[3-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate |
|---|---|
| PubChem CID | 54717643 |
| Molecular Formula | C22H19N2O7S2- |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 2-carboxy-5-[3-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCC(=O)Nc3ccc(C(=O)O)c([O-])c3)C2=O)cc1OC |
| InChI | InChI=1S/C22H20N2O7S2/c1-30-16-6-3-12(9-17(16)31-2)10-18-20(27)24(22(32)33-18)8-7-19(26)23-13-4-5-14(21(28)29)15(25)11-13/h3-6,9-11,25H,7-8H2,1-2H3,(H,23,26)(H,28,29)/p-1/b18-10- |
| InChIKey | WDJZIUOLNKYCCU-ZDLGFXPLSA-M |
| XLogP | 2.71 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|