C22H21ClN2O4S2 — CID 4758202
N-(4-chlorophenyl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4758202) has the molecular formula C22H21ClN2O4S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4758202 |
| Molecular Formula | C22H21ClN2O4S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-(4-chlorophenyl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCC(=O)Nc3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C22H21ClN2O4S2/c1-28-17-10-5-14(12-18(17)29-2)13-19-21(27)25(22(30)31-19)11-3-4-20(26)24-16-8-6-15(23)7-9-16/h5-10,12-13H,3-4,11H2,1-2H3,(H,24,26) |
| InChIKey | OHCUAILHRMIEFR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|