C22H19Cl3N2O4S2 — CID 4758207
4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 4758207) has the molecular formula C22H19Cl3N2O4S2 and a molecular weight of 545.90 g/mol. Its IUPAC name is 4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | 4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 4758207 |
| Molecular Formula | C22H19Cl3N2O4S2 |
| Molecular Weight | 545.90 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | 4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C22H19Cl3N2O4S2/c1-30-17-6-5-12(8-18(17)31-2)9-19-21(29)27(22(32)33-19)7-3-4-20(28)26-16-11-14(24)13(23)10-15(16)25/h5-6,8-11H,3-4,7H2,1-2H3,(H,26,28) |
| InChIKey | SSIPUCKOMBNBMO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|