C21H17Cl3N2O2S2 — CID 3763903
4-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 3763903) has the molecular formula C21H17Cl3N2O2S2 and a molecular weight of 499.87 g/mol. Its IUPAC name is 4-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | 4-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 3763903 |
| Molecular Formula | C21H17Cl3N2O2S2 |
| Molecular Weight | 499.87 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 4-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H17Cl3N2O2S2/c1-12-4-6-13(7-5-12)9-18-20(28)26(21(29)30-18)8-2-3-19(27)25-17-11-15(23)14(22)10-16(17)24/h4-7,9-11H,2-3,8H2,1H3,(H,25,27) |
| InChIKey | PLRDXOMSGBIVFU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.87 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|