C23H22Cl2N2O2S2 — CID 6203356
N-(2,3-dichlorophenyl)-6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 6203356) has the molecular formula C23H22Cl2N2O2S2 and a molecular weight of 493.48 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-(2,3-dichlorophenyl)-6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 6203356 |
| Molecular Formula | C23H22Cl2N2O2S2 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | Cc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)Nc3cccc(Cl)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O2S2/c1-15-9-11-16(12-10-15)14-19-22(29)27(23(30)31-19)13-4-2-3-8-20(28)26-18-7-5-6-17(24)21(18)25/h5-7,9-12,14H,2-4,8,13H2,1H3,(H,26,28)/b19-14- |
| InChIKey | WLHRNEGODIOYJK-RGEXLXHISA-N |
| XLogP | 6.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|