C24H24N2O4S2 — CID 4758961
2-[6-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid (PubChem CID 4758961) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-[6-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid.
| Compound Name | 2-[6-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid |
|---|---|
| PubChem CID | 4758961 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-[6-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoic acid |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCCCCC(=O)Nc3ccccc3C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C24H24N2O4S2/c1-16-10-12-17(13-11-16)15-20-22(28)26(24(31)32-20)14-6-2-3-9-21(27)25-19-8-5-4-7-18(19)23(29)30/h4-5,7-8,10-13,15H,2-3,6,9,14H2,1H3,(H,25,27)(H,29,30) |
| InChIKey | ZAUNCUNKRGWAGA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|