C24H25N3O3S2 — CID 6203420
N'-[6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]benzohydrazide (PubChem CID 6203420) has the molecular formula C24H25N3O3S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N'-[6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]benzohydrazide.
| Compound Name | N'-[6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]benzohydrazide |
|---|---|
| PubChem CID | 6203420 |
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N'-[6-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]benzohydrazide |
| SMILES | Cc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)NNC(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H25N3O3S2/c1-17-11-13-18(14-12-17)16-20-23(30)27(24(31)32-20)15-7-3-6-10-21(28)25-26-22(29)19-8-4-2-5-9-19/h2,4-5,8-9,11-14,16H,3,6-7,10,15H2,1H3,(H,25,28)(H,26,29)/b20-16- |
| InChIKey | UJHJORVVOVPOFJ-SILNSSARSA-N |
| XLogP | 4.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|