C23H21Cl3N2O3S2 — CID 4759080
6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)hexanamide (PubChem CID 4759080) has the molecular formula C23H21Cl3N2O3S2 and a molecular weight of 543.93 g/mol. Its IUPAC name is 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)hexanamide.
| Compound Name | 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)hexanamide |
|---|---|
| PubChem CID | 4759080 |
| Molecular Formula | C23H21Cl3N2O3S2 |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,5-trichlorophenyl)hexanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCCCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C23H21Cl3N2O3S2/c1-31-15-8-6-14(7-9-15)11-20-22(30)28(23(32)33-20)10-4-2-3-5-21(29)27-19-13-17(25)16(24)12-18(19)26/h6-9,11-13H,2-5,10H2,1H3,(H,27,29) |
| InChIKey | QPKSJPQOUYDBJP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|