C22H19N2O6S2- — CID 3427305
3-[3-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 3427305) has the molecular formula C22H19N2O6S2- and a molecular weight of 471.54 g/mol. Its IUPAC name is 3-[3-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | 3-[3-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 3427305 |
| Molecular Formula | C22H19N2O6S2- |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 3-[3-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | COc1ccc(C=C2SC(=S)N(CCC(=O)Nc3cccc(C(=O)[O-])c3)C2=O)cc1OC |
| InChI | InChI=1S/C22H20N2O6S2/c1-29-16-7-6-13(10-17(16)30-2)11-18-20(26)24(22(31)32-18)9-8-19(25)23-15-5-3-4-14(12-15)21(27)28/h3-7,10-12H,8-9H2,1-2H3,(H,23,25)(H,27,28)/p-1 |
| InChIKey | XWVJVIMJPDGWKC-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|