C22H14F3N3O3S2 — CID 4762448
N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzamide (PubChem CID 4762448) has the molecular formula C22H14F3N3O3S2 and a molecular weight of 489.50 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 4762448 |
| Molecular Formula | C22H14F3N3O3S2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(C=C3SC(=S)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)no1 |
| InChI | InChI=1S/C22H14F3N3O3S2/c1-12-9-18(27-31-12)26-19(29)14-7-5-13(6-8-14)10-17-20(30)28(21(32)33-17)16-4-2-3-15(11-16)22(23,24)25/h2-11H,1H3,(H,26,27,29) |
| InChIKey | RNFRMEHQRBOAOH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|