C21H15F3N2O4S3 — CID 87210783
4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid;1,3-thiazolidin-2-one (PubChem CID 87210783) has the molecular formula C21H15F3N2O4S3 and a molecular weight of 512.56 g/mol. Its IUPAC name is 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid;1,3-thiazolidin-2-one.
| Compound Name | 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid;1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 87210783 |
| Molecular Formula | C21H15F3N2O4S3 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]benzoic acid;1,3-thiazolidin-2-one |
| SMILES | O=C(O)c1ccc(C=C2SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1.O=C1NCCS1 |
| InChI | InChI=1S/C18H10F3NO3S2.C3H5NOS/c19-18(20,21)12-2-1-3-13(9-12)22-15(23)14(27-17(22)26)8-10-4-6-11(7-5-10)16(24)25;5-3-4-1-2-6-3/h1-9H,(H,24,25);1-2H2,(H,4,5) |
| InChIKey | UPVBNPCIUFFJOF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|